C12H22N2O2 — CID 75507355
1-(2,2-diethoxyethyl)piperidine-4-carbonitrile (PubChem CID 75507355) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)piperidine-4-carbonitrile.
| Compound Name | 1-(2,2-diethoxyethyl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 75507355 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-(2,2-diethoxyethyl)piperidine-4-carbonitrile |
| SMILES | CCOC(CN1CCC(C#N)CC1)OCC |
| InChI | InChI=1S/C12H22N2O2/c1-3-15-12(16-4-2)10-14-7-5-11(9-13)6-8-14/h11-12H,3-8,10H2,1-2H3 |
| InChIKey | VKLVLXPGZXEBJI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|