C16H31BrN2O — CID 65005472
2-[1-[2-(bromomethyl)-2-propylpentyl]piperidin-4-yl]acetamide (PubChem CID 65005472) has the molecular formula C16H31BrN2O and a molecular weight of 347.34 g/mol. Its IUPAC name is 2-[1-[2-(bromomethyl)-2-propylpentyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[1-[2-(bromomethyl)-2-propylpentyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 65005472 |
| Molecular Formula | C16H31BrN2O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[1-[2-(bromomethyl)-2-propylpentyl]piperidin-4-yl]acetamide |
| SMILES | CCCC(CBr)(CCC)CN1CCC(CC(N)=O)CC1 |
| InChI | InChI=1S/C16H31BrN2O/c1-3-7-16(12-17,8-4-2)13-19-9-5-14(6-10-19)11-15(18)20/h14H,3-13H2,1-2H3,(H2,18,20) |
| InChIKey | DGXLYWKXMIXGNC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|