C16H32N2O2 — CID 63629128
1-cyclopentyl-4-(3,3-diethoxypropyl)piperazine (PubChem CID 63629128) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-cyclopentyl-4-(3,3-diethoxypropyl)piperazine.
| Compound Name | 1-cyclopentyl-4-(3,3-diethoxypropyl)piperazine |
|---|---|
| PubChem CID | 63629128 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 1-cyclopentyl-4-(3,3-diethoxypropyl)piperazine |
| SMILES | CCOC(CCN1CCN(C2CCCC2)CC1)OCC |
| InChI | InChI=1S/C16H32N2O2/c1-3-19-16(20-4-2)9-10-17-11-13-18(14-12-17)15-7-5-6-8-15/h15-16H,3-14H2,1-2H3 |
| InChIKey | LAOLDCNCKNRMBM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|