C12H25NO3 — CID 63629790
1-(3,3-diethoxypropyl)piperidin-3-ol (PubChem CID 63629790) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)piperidin-3-ol.
| Compound Name | 1-(3,3-diethoxypropyl)piperidin-3-ol |
|---|---|
| PubChem CID | 63629790 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-(3,3-diethoxypropyl)piperidin-3-ol |
| SMILES | CCOC(CCN1CCCC(O)C1)OCC |
| InChI | InChI=1S/C12H25NO3/c1-3-15-12(16-4-2)7-9-13-8-5-6-11(14)10-13/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | VJTMJDGIKPOCSL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|