C14H19Br — CID 141477429
1-bromo-1,2,2,3,3-pentamethylindene (PubChem CID 141477429) has the molecular formula C14H19Br and a molecular weight of 267.21 g/mol. Its IUPAC name is 1-bromo-1,2,2,3,3-pentamethylindene.
| Compound Name | 1-bromo-1,2,2,3,3-pentamethylindene |
|---|---|
| PubChem CID | 141477429 |
| Molecular Formula | C14H19Br |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-bromo-1,2,2,3,3-pentamethylindene |
| SMILES | CC1(C)c2ccccc2C(C)(Br)C1(C)C |
| InChI | InChI=1S/C14H19Br/c1-12(2)10-8-6-7-9-11(10)14(5,15)13(12,3)4/h6-9H,1-5H3 |
| InChIKey | SFTGMOWXNBFMNN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|