C18H18Br2 — CID 139978488
1,1-dibromo-2,2,3-trimethyl-3-phenylindene (PubChem CID 139978488) has the molecular formula C18H18Br2 and a molecular weight of 394.15 g/mol. Its IUPAC name is 1,1-dibromo-2,2,3-trimethyl-3-phenylindene.
| Compound Name | 1,1-dibromo-2,2,3-trimethyl-3-phenylindene |
|---|---|
| PubChem CID | 139978488 |
| Molecular Formula | C18H18Br2 |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | 1,1-dibromo-2,2,3-trimethyl-3-phenylindene |
| SMILES | CC1(c2ccccc2)c2ccccc2C(Br)(Br)C1(C)C |
| InChI | InChI=1S/C18H18Br2/c1-16(2)17(3,13-9-5-4-6-10-13)14-11-7-8-12-15(14)18(16,19)20/h4-12H,1-3H3 |
| InChIKey | XWKWFFJZNYRPRG-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|