C24H28 — CID 134979823
1,3,3,4,6,6-hexamethyl-2,5-diphenyltricyclo[3.1.0.02,4]hexane (PubChem CID 134979823) has the molecular formula C24H28 and a molecular weight of 316.49 g/mol. Its IUPAC name is 1,3,3,4,6,6-hexamethyl-2,5-diphenyltricyclo[3.1.0.02,4]hexane.
| Compound Name | 1,3,3,4,6,6-hexamethyl-2,5-diphenyltricyclo[3.1.0.02,4]hexane |
|---|---|
| PubChem CID | 134979823 |
| Molecular Formula | C24H28 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1,3,3,4,6,6-hexamethyl-2,5-diphenyltricyclo[3.1.0.02,4]hexane |
| SMILES | CC1(C)C2(C)C1(c1ccccc1)C1(C)C(C)(C)C21c1ccccc1 |
| InChI | InChI=1S/C24H28/c1-19(2)21(5)23(19,17-13-9-7-10-14-17)22(6)20(3,4)24(21,22)18-15-11-8-12-16-18/h7-16H,1-6H3 |
| InChIKey | FQFYYPOAXNOCRJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |