About methanimine;(1-methylcyclopropyl)benzene
methanimine;(1-methylcyclopropyl)benzene (PubChem CID 163372964) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is methanimine;(1-methylcyclopropyl)benzene.
Molecular Properties
| Compound Name | methanimine;(1-methylcyclopropyl)benzene |
| PubChem CID | 163372964 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | methanimine;(1-methylcyclopropyl)benzene |
| SMILES | CC1(c2ccccc2)CC1.[H]N=C |
| InChI | InChI=1S/C10H12.CH3N/c1-10(7-8-10)9-5-3-2-4-6-9;1-2/h2-6H,7-8H2,1H3;2H,1H2 |
| InChIKey | VSPDLSMQNZBDFF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methanimine;(1-methylcyclopropyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanimine;(1-methylcyclopropyl)benzene?
The IUPAC name of methanimine;(1-methylcyclopropyl)benzene (CID 163372964) is methanimine;(1-methylcyclopropyl)benzene.
What is the SMILES notation for methanimine;(1-methylcyclopropyl)benzene?
The canonical SMILES for methanimine;(1-methylcyclopropyl)benzene is CC1(c2ccccc2)CC1.[H]N=C.
What is the InChIKey of methanimine;(1-methylcyclopropyl)benzene?
The InChIKey is VSPDLSMQNZBDFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.CH3N/c1-10(7-8-10)9-5-3-2-4-6-9;1-2/h2-6H,7-8H2,1H3;2H,1H2.
What are the key properties of methanimine;(1-methylcyclopropyl)benzene?
methanimine;(1-methylcyclopropyl)benzene has a molecular weight of 161.25 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanimine;(1-methylcyclopropyl)benzene is sourced from PubChem (CID 163372964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).