C25H22 — CID 134979898
(2R,4R,6R)-2,6-dimethyl-3,4-diphenyltetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-triene (PubChem CID 134979898) has the molecular formula C25H22 and a molecular weight of 322.45 g/mol. Its IUPAC name is (2R,4R,6R)-2,6-dimethyl-3,4-diphenyltetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-triene.
| Compound Name | (2R,4R,6R)-2,6-dimethyl-3,4-diphenyltetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-triene |
|---|---|
| PubChem CID | 134979898 |
| Molecular Formula | C25H22 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2R,4R,6R)-2,6-dimethyl-3,4-diphenyltetracyclo[5.4.0.02,4.03,6]undeca-1(11),7,9-triene |
| SMILES | C[C@@]12c3ccccc3[C@@]3(C)C[C@]1(c1ccccc1)C23c1ccccc1 |
| InChI | InChI=1S/C25H22/c1-22-17-24(18-11-5-3-6-12-18)23(2,21-16-10-9-15-20(21)22)25(22,24)19-13-7-4-8-14-19/h3-16H,17H2,1-2H3/t22-,23-,24-,25?/m1/s1 |
| InChIKey | NQIGAWDVFQVYTN-AWYPOSSQSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |