C19H22O — CID 145427653
(4,4-dimethyl-1-phenylcyclopent-2-en-1-yl)benzene;hydrate (PubChem CID 145427653) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is (4,4-dimethyl-1-phenylcyclopent-2-en-1-yl)benzene;hydrate.
| Compound Name | (4,4-dimethyl-1-phenylcyclopent-2-en-1-yl)benzene;hydrate |
|---|---|
| PubChem CID | 145427653 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (4,4-dimethyl-1-phenylcyclopent-2-en-1-yl)benzene;hydrate |
| SMILES | CC1(C)C=CC(c2ccccc2)(c2ccccc2)C1.O |
| InChI | InChI=1S/C19H20.H2O/c1-18(2)13-14-19(15-18,16-9-5-3-6-10-16)17-11-7-4-8-12-17;/h3-14H,15H2,1-2H3;1H2 |
| InChIKey | BYRRNIXYLZWFEN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|