C12H12Br2 — CID 46918541
2,2-dibromo-1-methyl-1-phenylspiro[2.2]pentane (PubChem CID 46918541) has the molecular formula C12H12Br2 and a molecular weight of 316.04 g/mol. Its IUPAC name is 2,2-dibromo-1-methyl-1-phenylspiro[2.2]pentane.
| Compound Name | 2,2-dibromo-1-methyl-1-phenylspiro[2.2]pentane |
|---|---|
| PubChem CID | 46918541 |
| Molecular Formula | C12H12Br2 |
| Molecular Weight | 316.04 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | 2,2-dibromo-1-methyl-1-phenylspiro[2.2]pentane |
| SMILES | CC1(c2ccccc2)C(Br)(Br)C12CC2 |
| InChI | InChI=1S/C12H12Br2/c1-10(9-5-3-2-4-6-9)11(7-8-11)12(10,13)14/h2-6H,7-8H2,1H3 |
| InChIKey | AWMLDYUUDCVKOD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.04 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|