C20H20O4 — CID 102180606
(1S,14S,16R,19R)-16,19-dimethyl-15,18-dioxapentacyclo[12.3.3.01,14.02,7.08,13]icosa-2,4,6,8,10,12-hexaene-16,19-diol (PubChem CID 102180606) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (1S,14S,16R,19R)-16,19-dimethyl-15,18-dioxapentacyclo[12.3.3.01,14.02,7.08,13]icosa-2,4,6,8,10,12-hexaene-16,19-diol.
| Compound Name | (1S,14S,16R,19R)-16,19-dimethyl-15,18-dioxapentacyclo[12.3.3.01,14.02,7.08,13]icosa-2,4,6,8,10,12-hexaene-16,19-diol |
|---|---|
| PubChem CID | 102180606 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (1S,14S,16R,19R)-16,19-dimethyl-15,18-dioxapentacyclo[12.3.3.01,14.02,7.08,13]icosa-2,4,6,8,10,12-hexaene-16,19-diol |
| SMILES | C[C@]1(O)C[C@@]23O[C@@](C)(O)C[C@]2(O1)c1ccccc1-c1ccccc13 |
| InChI | InChI=1S/C20H20O4/c1-17(21)11-19-15-9-5-3-7-13(15)14-8-4-6-10-16(14)20(19,23-17)12-18(2,22)24-19/h3-10,21-22H,11-12H2,1-2H3/t17-,18-,19+,20+/m1/s1 |
| InChIKey | YUBIVISODGNDCQ-ZRNYENFQSA-N |
| XLogP | 3.02 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |