C24H35F3Si — CID 123185120
9,9-dimethylfluorene;tetramethylsilane;1,1,1-trifluoro-2,2-dimethylpropane (PubChem CID 123185120) has the molecular formula C24H35F3Si and a molecular weight of 408.62 g/mol. Its IUPAC name is 9,9-dimethylfluorene;tetramethylsilane;1,1,1-trifluoro-2,2-dimethylpropane.
| Compound Name | 9,9-dimethylfluorene;tetramethylsilane;1,1,1-trifluoro-2,2-dimethylpropane |
|---|---|
| PubChem CID | 123185120 |
| Molecular Formula | C24H35F3Si |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 9,9-dimethylfluorene;tetramethylsilane;1,1,1-trifluoro-2,2-dimethylpropane |
| SMILES | CC(C)(C)C(F)(F)F.CC1(C)c2ccccc2-c2ccccc21.C[Si](C)(C)C |
| InChI | InChI=1S/C15H14.C5H9F3.C4H12Si/c1-15(2)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-4(2,3)5(6,7)8;1-5(2,3)4/h3-10H,1-2H3;1-3H3;1-4H3 |
| InChIKey | WVGUDNGDZWHJDB-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|