C15H14 — CID 175772384
1,2-dideuterio-9,9-dimethylfluorene (PubChem CID 175772384) has the molecular formula C15H14 and a molecular weight of 196.29 g/mol. Its IUPAC name is 1,2-dideuterio-9,9-dimethylfluorene.
| Compound Name | 1,2-dideuterio-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 175772384 |
| Molecular Formula | C15H14 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1,2-dideuterio-9,9-dimethylfluorene |
| SMILES | [2H]c1ccc2c(c1[2H])C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C15H14/c1-15(2)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h3-10H,1-2H3/i5D,9D |
| InChIKey | ZHQNDEHZACHHTA-YVOYOWBUSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |