C17H17Br — CID 11066754
9-(2-bromo-1,1,1,3,3,3-hexadeuteriopropan-2-yl)-9-methylfluorene (PubChem CID 11066754) has the molecular formula C17H17Br and a molecular weight of 307.26 g/mol. Its IUPAC name is 9-(2-bromo-1,1,1,3,3,3-hexadeuteriopropan-2-yl)-9-methylfluorene.
| Compound Name | 9-(2-bromo-1,1,1,3,3,3-hexadeuteriopropan-2-yl)-9-methylfluorene |
|---|---|
| PubChem CID | 11066754 |
| Molecular Formula | C17H17Br |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 9-(2-bromo-1,1,1,3,3,3-hexadeuteriopropan-2-yl)-9-methylfluorene |
| SMILES | [2H]C([2H])([2H])C(Br)(C([2H])([2H])[2H])C1(C)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H17Br/c1-16(2,18)17(3)14-10-6-4-8-12(14)13-9-5-7-11-15(13)17/h4-11H,1-3H3/i1D3,2D3 |
| InChIKey | CKYJGHWPKOPSJO-WFGJKAKNSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|