C17H28 — CID 90797870
ethane;1,1,2,3-tetramethylindene (PubChem CID 90797870) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is ethane;1,1,2,3-tetramethylindene.
| Compound Name | ethane;1,1,2,3-tetramethylindene |
|---|---|
| PubChem CID | 90797870 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | ethane;1,1,2,3-tetramethylindene |
| SMILES | CC.CC.CC1=C(C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C13H16.2C2H6/c1-9-10(2)13(3,4)12-8-6-5-7-11(9)12;2*1-2/h5-8H,1-4H3;2*1-2H3 |
| InChIKey | OWPYLQOMWKQQKB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |