C18H20O — CID 144874508
propane;spiro[fluorene-9,3'-oxetane] (PubChem CID 144874508) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is propane;spiro[fluorene-9,3'-oxetane].
| Compound Name | propane;spiro[fluorene-9,3'-oxetane] |
|---|---|
| PubChem CID | 144874508 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | propane;spiro[fluorene-9,3'-oxetane] |
| SMILES | CCC.c1ccc2c(c1)-c1ccccc1C21COC1 |
| InChI | InChI=1S/C15H12O.C3H8/c1-3-7-13-11(5-1)12-6-2-4-8-14(12)15(13)9-16-10-15;1-3-2/h1-8H,9-10H2;3H2,1-2H3 |
| InChIKey | AYLHZCIQXXBVRV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |