About 10-methylidenespiro[anthracene-9,1'-cyclopropane]
10-methylidenespiro[anthracene-9,1'-cyclopropane] (PubChem CID 12648503) has the molecular formula C17H14
and a molecular weight of 218.30 g/mol. Its IUPAC name is 10-methylidenespiro[anthracene-9,1'-cyclopropane].
Molecular Properties
| Compound Name | 10-methylidenespiro[anthracene-9,1'-cyclopropane] |
| PubChem CID | 12648503 |
| Molecular Formula | C17H14 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 10-methylidenespiro[anthracene-9,1'-cyclopropane] |
| SMILES | C=C1c2ccccc2C2(CC2)c2ccccc21 |
| InChI | InChI=1S/C17H14/c1-12-13-6-2-4-8-15(13)17(10-11-17)16-9-5-3-7-14(12)16/h2-9H,1,10-11H2 |
| InChIKey | ZGACXXTXIWUYMX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 10-methylidenespiro[anthracene-9,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methylidenespiro[anthracene-9,1'-cyclopropane]?
The IUPAC name of 10-methylidenespiro[anthracene-9,1'-cyclopropane] (CID 12648503) is 10-methylidenespiro[anthracene-9,1'-cyclopropane].
What is the SMILES notation for 10-methylidenespiro[anthracene-9,1'-cyclopropane]?
The canonical SMILES for 10-methylidenespiro[anthracene-9,1'-cyclopropane] is C=C1c2ccccc2C2(CC2)c2ccccc21.
What is the InChIKey of 10-methylidenespiro[anthracene-9,1'-cyclopropane]?
The InChIKey is ZGACXXTXIWUYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14/c1-12-13-6-2-4-8-15(13)17(10-11-17)16-9-5-3-7-14(12)16/h2-9H,1,10-11H2.
What are the key properties of 10-methylidenespiro[anthracene-9,1'-cyclopropane]?
10-methylidenespiro[anthracene-9,1'-cyclopropane] has a molecular weight of 218.30 g/mol, XLogP of 4.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylidenespiro[anthracene-9,1'-cyclopropane] is sourced from PubChem (CID 12648503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).