C11H8F2 — CID 123480642
1,1-difluoro-2,3-dimethylideneindene (PubChem CID 123480642) has the molecular formula C11H8F2 and a molecular weight of 178.18 g/mol. Its IUPAC name is 1,1-difluoro-2,3-dimethylideneindene.
| Compound Name | 1,1-difluoro-2,3-dimethylideneindene |
|---|---|
| PubChem CID | 123480642 |
| Molecular Formula | C11H8F2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 1,1-difluoro-2,3-dimethylideneindene |
| SMILES | C=C1C(=C)C(F)(F)c2ccccc21 |
| InChI | InChI=1S/C11H8F2/c1-7-8(2)11(12,13)10-6-4-3-5-9(7)10/h3-6H,1-2H2 |
| InChIKey | YLNNXPXFUTXIQN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |