C19H11F3O — CID 154343260
9-(3,4,5-trifluorophenyl)fluoren-9-ol (PubChem CID 154343260) has the molecular formula C19H11F3O and a molecular weight of 312.29 g/mol. Its IUPAC name is 9-(3,4,5-trifluorophenyl)fluoren-9-ol.
| Compound Name | 9-(3,4,5-trifluorophenyl)fluoren-9-ol |
|---|---|
| PubChem CID | 154343260 |
| Molecular Formula | C19H11F3O |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 9-(3,4,5-trifluorophenyl)fluoren-9-ol |
| SMILES | OC1(c2cc(F)c(F)c(F)c2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H11F3O/c20-16-9-11(10-17(21)18(16)22)19(23)14-7-3-1-5-12(14)13-6-2-4-8-15(13)19/h1-10,23H |
| InChIKey | HXDSANKWUBMMHZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|