C13H10O — CID 87437290
7-phenylbicyclo[4.1.0]hepta-1,3,5-trien-7-ol (PubChem CID 87437290) has the molecular formula C13H10O and a molecular weight of 182.22 g/mol. Its IUPAC name is 7-phenylbicyclo[4.1.0]hepta-1,3,5-trien-7-ol.
| Compound Name | 7-phenylbicyclo[4.1.0]hepta-1,3,5-trien-7-ol |
|---|---|
| PubChem CID | 87437290 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 7-phenylbicyclo[4.1.0]hepta-1,3,5-trien-7-ol |
| SMILES | OC1(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C13H10O/c14-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)13/h1-9,14H |
| InChIKey | TVJRJBMPXVWNAO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |