C24H22O3 — CID 10522386
(1S,4S)-2,3-dimethyl-1,4-diphenylnaphthalene-1,4,5-triol (PubChem CID 10522386) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (1S,4S)-2,3-dimethyl-1,4-diphenylnaphthalene-1,4,5-triol.
| Compound Name | (1S,4S)-2,3-dimethyl-1,4-diphenylnaphthalene-1,4,5-triol |
|---|---|
| PubChem CID | 10522386 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (1S,4S)-2,3-dimethyl-1,4-diphenylnaphthalene-1,4,5-triol |
| SMILES | CC1=C(C)[C@@](O)(c2ccccc2)c2c(O)cccc2[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C24H22O3/c1-16-17(2)24(27,19-12-7-4-8-13-19)22-20(14-9-15-21(22)25)23(16,26)18-10-5-3-6-11-18/h3-15,25-27H,1-2H3/t23-,24-/m1/s1 |
| InChIKey | FQJSPKGJZUISJN-DNQXCXABSA-N |
| XLogP | 4.21 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|