C17H14O2 — CID 10444794
4-hydroxy-2-methyl-3,4-diphenylcyclobut-2-en-1-one (PubChem CID 10444794) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-3,4-diphenylcyclobut-2-en-1-one.
| Compound Name | 4-hydroxy-2-methyl-3,4-diphenylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10444794 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-hydroxy-2-methyl-3,4-diphenylcyclobut-2-en-1-one |
| SMILES | CC1=C(c2ccccc2)C(O)(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H14O2/c1-12-15(13-8-4-2-5-9-13)17(19,16(12)18)14-10-6-3-7-11-14/h2-11,19H,1H3 |
| InChIKey | NNBWALQSEUSXJB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |