C38H32O2 — CID 124923868
(1S,2R,6R,7S)-1,2,4,7-tetramethyl-5,6,8,9-tetraphenyltricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione (PubChem CID 124923868) has the molecular formula C38H32O2 and a molecular weight of 520.67 g/mol. Its IUPAC name is (1S,2R,6R,7S)-1,2,4,7-tetramethyl-5,6,8,9-tetraphenyltricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione.
| Compound Name | (1S,2R,6R,7S)-1,2,4,7-tetramethyl-5,6,8,9-tetraphenyltricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione |
|---|---|
| PubChem CID | 124923868 |
| Molecular Formula | C38H32O2 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | (1S,2R,6R,7S)-1,2,4,7-tetramethyl-5,6,8,9-tetraphenyltricyclo[5.2.1.02,6]deca-4,8-diene-3,10-dione |
| SMILES | CC1=C(c2ccccc2)[C@]2(c3ccccc3)[C@@]3(C)C(=O)[C@@](C)(C(c4ccccc4)=C3c3ccccc3)[C@]2(C)C1=O |
| InChI | InChI=1S/C38H32O2/c1-25-30(26-17-9-5-10-18-26)38(29-23-15-8-16-24-29)36(3)32(28-21-13-7-14-22-28)31(27-19-11-6-12-20-27)35(2,34(36)40)37(38,4)33(25)39/h5-24H,1-4H3/t35-,36-,37+,38-/m1/s1 |
| InChIKey | NBMUMLNUVRPNNO-UXWDSZNOSA-N |
| XLogP | 8.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|