C24H24O2 — CID 101414822
(1R,6S)-1,3,4,6-tetramethyl-7,7-diphenylbicyclo[4.2.0]oct-3-ene-2,5-dione (PubChem CID 101414822) has the molecular formula C24H24O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is (1R,6S)-1,3,4,6-tetramethyl-7,7-diphenylbicyclo[4.2.0]oct-3-ene-2,5-dione.
| Compound Name | (1R,6S)-1,3,4,6-tetramethyl-7,7-diphenylbicyclo[4.2.0]oct-3-ene-2,5-dione |
|---|---|
| PubChem CID | 101414822 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (1R,6S)-1,3,4,6-tetramethyl-7,7-diphenylbicyclo[4.2.0]oct-3-ene-2,5-dione |
| SMILES | CC1=C(C)C(=O)[C@@]2(C)C(c3ccccc3)(c3ccccc3)C[C@@]2(C)C1=O |
| InChI | InChI=1S/C24H24O2/c1-16-17(2)21(26)23(4)22(3,20(16)25)15-24(23,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14H,15H2,1-4H3/t22-,23+/m0/s1 |
| InChIKey | ZZPDJXXCEQLLQM-XZOQPEGZSA-N |
| XLogP | 4.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |