C31H24O — CID 92835890
(10R,11S,14R,15S)-11,14-dimethyl-12,13-diphenylpentacyclo[7.6.1.111,14.05,16.010,15]heptadeca-1,3,5(16),6,8,12-hexaen-17-one (PubChem CID 92835890) has the molecular formula C31H24O and a molecular weight of 412.53 g/mol. Its IUPAC name is (10R,11S,14R,15S)-11,14-dimethyl-12,13-diphenylpentacyclo[7.6.1.111,14.05,16.010,15]heptadeca-1,3,5(16),6,8,12-hexaen-17-one.
| Compound Name | (10R,11S,14R,15S)-11,14-dimethyl-12,13-diphenylpentacyclo[7.6.1.111,14.05,16.010,15]heptadeca-1,3,5(16),6,8,12-hexaen-17-one |
|---|---|
| PubChem CID | 92835890 |
| Molecular Formula | C31H24O |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (10R,11S,14R,15S)-11,14-dimethyl-12,13-diphenylpentacyclo[7.6.1.111,14.05,16.010,15]heptadeca-1,3,5(16),6,8,12-hexaen-17-one |
| SMILES | C[C@]12C(=O)[C@](C)(C(c3ccccc3)=C1c1ccccc1)[C@H]1c3cccc4cccc(c34)[C@H]12 |
| InChI | InChI=1S/C31H24O/c1-30-25(20-11-5-3-6-12-20)26(21-13-7-4-8-14-21)31(2,29(30)32)28-23-18-10-16-19-15-9-17-22(24(19)23)27(28)30/h3-18,27-28H,1-2H3/t27-,28+,30+,31- |
| InChIKey | YZJNINMFAVGVBQ-ALJLHCSFSA-N |
| XLogP | 7.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|