C33H25NO3 — CID 9497679
(1S,2S,6R,7R)-1,7-dimethyl-4-naphthalen-1-yl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 9497679) has the molecular formula C33H25NO3 and a molecular weight of 483.57 g/mol. Its IUPAC name is (1S,2S,6R,7R)-1,7-dimethyl-4-naphthalen-1-yl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1S,2S,6R,7R)-1,7-dimethyl-4-naphthalen-1-yl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 9497679 |
| Molecular Formula | C33H25NO3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (1S,2S,6R,7R)-1,7-dimethyl-4-naphthalen-1-yl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | C[C@]12C(=O)[C@](C)(C(c3ccccc3)=C1c1ccccc1)[C@H]1C(=O)N(c3cccc4ccccc34)C(=O)[C@H]12 |
| InChI | InChI=1S/C33H25NO3/c1-32-25(21-13-5-3-6-14-21)26(22-15-7-4-8-16-22)33(2,31(32)37)28-27(32)29(35)34(30(28)36)24-19-11-17-20-12-9-10-18-23(20)24/h3-19,27-28H,1-2H3/t27-,28+,32-,33+ |
| InChIKey | UATOLYRPWRIZES-FLLYCIPJSA-N |
| XLogP | 6.17 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|