C31H26BrNO3 — CID 9497684
(1R,2R,6S,7S)-4-(3-bromophenyl)-1-methyl-8,9-diphenyl-7-propyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 9497684) has the molecular formula C31H26BrNO3 and a molecular weight of 540.46 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-(3-bromophenyl)-1-methyl-8,9-diphenyl-7-propyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1R,2R,6S,7S)-4-(3-bromophenyl)-1-methyl-8,9-diphenyl-7-propyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 9497684 |
| Molecular Formula | C31H26BrNO3 |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | (1R,2R,6S,7S)-4-(3-bromophenyl)-1-methyl-8,9-diphenyl-7-propyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | CCC[C@@]12C(=O)[C@@](C)(C(c3ccccc3)=C1c1ccccc1)[C@@H]1C(=O)N(c3cccc(Br)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C31H26BrNO3/c1-3-17-31-24(20-13-8-5-9-14-20)23(19-11-6-4-7-12-19)30(2,29(31)36)25-26(31)28(35)33(27(25)34)22-16-10-15-21(32)18-22/h4-16,18,25-26H,3,17H2,1-2H3/t25-,26+,30-,31+/m0/s1 |
| InChIKey | SIRLVKGYDCUFAD-KNWZFJHESA-N |
| XLogP | 6.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|