C33H31NO4 — CID 98152324
(1R,2R,6S,7R)-4-(4-ethoxyphenyl)-1-methyl-8,9-diphenyl-7-propyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 98152324) has the molecular formula C33H31NO4 and a molecular weight of 505.61 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-(4-ethoxyphenyl)-1-methyl-8,9-diphenyl-7-propyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1R,2R,6S,7R)-4-(4-ethoxyphenyl)-1-methyl-8,9-diphenyl-7-propyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 98152324 |
| Molecular Formula | C33H31NO4 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (1R,2R,6S,7R)-4-(4-ethoxyphenyl)-1-methyl-8,9-diphenyl-7-propyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | CCC[C@]12C(=O)[C@@](C)(C(c3ccccc3)=C1c1ccccc1)[C@@H]1C(=O)N(c3ccc(OCC)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C33H31NO4/c1-4-20-33-26(22-14-10-7-11-15-22)25(21-12-8-6-9-13-21)32(3,31(33)37)27-28(33)30(36)34(29(27)35)23-16-18-24(19-17-23)38-5-2/h6-19,27-28H,4-5,20H2,1-3H3/t27-,28+,32-,33-/m0/s1 |
| InChIKey | SRAWLPBSZNTHGI-SNJRAOIRSA-N |
| XLogP | 6.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|