C17H14O2 — CID 71418523
(1S)-2-methyl-1,3-diphenylcycloprop-2-ene-1-carboxylic acid (PubChem CID 71418523) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (1S)-2-methyl-1,3-diphenylcycloprop-2-ene-1-carboxylic acid.
| Compound Name | (1S)-2-methyl-1,3-diphenylcycloprop-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 71418523 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (1S)-2-methyl-1,3-diphenylcycloprop-2-ene-1-carboxylic acid |
| SMILES | CC1=C(c2ccccc2)[C@]1(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H14O2/c1-12-15(13-8-4-2-5-9-13)17(12,16(18)19)14-10-6-3-7-11-14/h2-11H,1H3,(H,18,19)/t17-/m1/s1 |
| InChIKey | ZHNPFUFOTKZZQX-QGZVFWFLSA-N |
| XLogP | 3.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |