C28H28O8 — CID 101226398
tetramethyl 2,5-dimethyl-3,6-diphenylcyclohexa-2,5-diene-1,1,4,4-tetracarboxylate (PubChem CID 101226398) has the molecular formula C28H28O8 and a molecular weight of 492.52 g/mol. Its IUPAC name is tetramethyl 2,5-dimethyl-3,6-diphenylcyclohexa-2,5-diene-1,1,4,4-tetracarboxylate.
| Compound Name | tetramethyl 2,5-dimethyl-3,6-diphenylcyclohexa-2,5-diene-1,1,4,4-tetracarboxylate |
|---|---|
| PubChem CID | 101226398 |
| Molecular Formula | C28H28O8 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | tetramethyl 2,5-dimethyl-3,6-diphenylcyclohexa-2,5-diene-1,1,4,4-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(C)=C(c2ccccc2)C(C(=O)OC)(C(=O)OC)C(C)=C1c1ccccc1 |
| InChI | InChI=1S/C28H28O8/c1-17-21(19-13-9-7-10-14-19)28(25(31)35-5,26(32)36-6)18(2)22(20-15-11-8-12-16-20)27(17,23(29)33-3)24(30)34-4/h7-16H,1-6H3 |
| InChIKey | CEHBVOSUOGPUCJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|