C28H28O6 — CID 100990354
6-O-ethyl 2-O,5-O-dimethyl 8-methyl-3,4-diphenyltricyclo[3.2.1.02,7]oct-3-ene-2,5,6-tricarboxylate (PubChem CID 100990354) has the molecular formula C28H28O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is 6-O-ethyl 2-O,5-O-dimethyl 8-methyl-3,4-diphenyltricyclo[3.2.1.02,7]oct-3-ene-2,5,6-tricarboxylate.
| Compound Name | 6-O-ethyl 2-O,5-O-dimethyl 8-methyl-3,4-diphenyltricyclo[3.2.1.02,7]oct-3-ene-2,5,6-tricarboxylate |
|---|---|
| PubChem CID | 100990354 |
| Molecular Formula | C28H28O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 6-O-ethyl 2-O,5-O-dimethyl 8-methyl-3,4-diphenyltricyclo[3.2.1.02,7]oct-3-ene-2,5,6-tricarboxylate |
| SMILES | CCOC(=O)C1C2C3C(C)C1(C(=O)OC)C(c1ccccc1)=C(c1ccccc1)C32C(=O)OC |
| InChI | InChI=1S/C28H28O6/c1-5-34-24(29)23-22-19-16(2)27(23,25(30)32-3)20(17-12-8-6-9-13-17)21(18-14-10-7-11-15-18)28(19,22)26(31)33-4/h6-16,19,22-23H,5H2,1-4H3 |
| InChIKey | FVYMHMFWKGNSHU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|