C29H30O6 — CID 100990360
7-O-ethyl 2-O,3a-O-dimethyl (3aS,4S,7R,7aS)-4-methyl-1,7a-diphenyl-4,7-dihydro-3H-indene-2,3a,7-tricarboxylate (PubChem CID 100990360) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is 7-O-ethyl 2-O,3a-O-dimethyl (3aS,4S,7R,7aS)-4-methyl-1,7a-diphenyl-4,7-dihydro-3H-indene-2,3a,7-tricarboxylate.
| Compound Name | 7-O-ethyl 2-O,3a-O-dimethyl (3aS,4S,7R,7aS)-4-methyl-1,7a-diphenyl-4,7-dihydro-3H-indene-2,3a,7-tricarboxylate |
|---|---|
| PubChem CID | 100990360 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 7-O-ethyl 2-O,3a-O-dimethyl (3aS,4S,7R,7aS)-4-methyl-1,7a-diphenyl-4,7-dihydro-3H-indene-2,3a,7-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1C=C[C@H](C)[C@@]2(C(=O)OC)CC(C(=O)OC)=C(c3ccccc3)[C@@]12c1ccccc1 |
| InChI | InChI=1S/C29H30O6/c1-5-35-26(31)23-17-16-19(2)28(27(32)34-4)18-22(25(30)33-3)24(20-12-8-6-9-13-20)29(23,28)21-14-10-7-11-15-21/h6-17,19,23H,5,18H2,1-4H3/t19-,23-,28+,29+/m0/s1 |
| InChIKey | IYIYCHWGFARCFH-YUYPUHHXSA-N |
| XLogP | 4.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|