C24H25NO6 — CID 101355084
3-O,4-O-diethyl 2-O-methyl (2R,3S,4S)-2,5-diphenyl-3,4-dihydropyrrole-2,3,4-tricarboxylate (PubChem CID 101355084) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-O,4-O-diethyl 2-O-methyl (2R,3S,4S)-2,5-diphenyl-3,4-dihydropyrrole-2,3,4-tricarboxylate.
| Compound Name | 3-O,4-O-diethyl 2-O-methyl (2R,3S,4S)-2,5-diphenyl-3,4-dihydropyrrole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 101355084 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 3-O,4-O-diethyl 2-O-methyl (2R,3S,4S)-2,5-diphenyl-3,4-dihydropyrrole-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(c2ccccc2)=N[C@@](C(=O)OC)(c2ccccc2)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C24H25NO6/c1-4-30-21(26)18-19(22(27)31-5-2)24(23(28)29-3,17-14-10-7-11-15-17)25-20(18)16-12-8-6-9-13-16/h6-15,18-19H,4-5H2,1-3H3/t18-,19+,24-/m0/s1 |
| InChIKey | DRJAQGBNMZJKCK-GLDPYIMESA-N |
| XLogP | 2.92 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|