C30H30N2O6 — CID 11038561
diethyl (3aR,4S,5R,6aS)-6-anilino-5-hydroxy-2,5-diphenyl-4,6a-dihydro-3aH-furo[2,3-b]pyrrole-3,4-dicarboxylate (PubChem CID 11038561) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is diethyl (3aR,4S,5R,6aS)-6-anilino-5-hydroxy-2,5-diphenyl-4,6a-dihydro-3aH-furo[2,3-b]pyrrole-3,4-dicarboxylate.
| Compound Name | diethyl (3aR,4S,5R,6aS)-6-anilino-5-hydroxy-2,5-diphenyl-4,6a-dihydro-3aH-furo[2,3-b]pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11038561 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | diethyl (3aR,4S,5R,6aS)-6-anilino-5-hydroxy-2,5-diphenyl-4,6a-dihydro-3aH-furo[2,3-b]pyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)O[C@H]2[C@@H]1[C@H](C(=O)OCC)[C@@](O)(c1ccccc1)N2Nc1ccccc1 |
| InChI | InChI=1S/C30H30N2O6/c1-3-36-28(33)24-23-25(29(34)37-4-2)30(35,21-16-10-6-11-17-21)32(31-22-18-12-7-13-19-22)27(23)38-26(24)20-14-8-5-9-15-20/h5-19,23,25,27,31,35H,3-4H2,1-2H3/t23-,25+,27-,30-/m0/s1 |
| InChIKey | CSNQAZCTGITZBJ-ZOMOEZKFSA-N |
| XLogP | 4.30 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |