C19H27NO5 — CID 75011540
diethyl 5-hydroxy-1,6-dimethyl-5-phenylpiperidine-3,4-dicarboxylate (PubChem CID 75011540) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is diethyl 5-hydroxy-1,6-dimethyl-5-phenylpiperidine-3,4-dicarboxylate.
| Compound Name | diethyl 5-hydroxy-1,6-dimethyl-5-phenylpiperidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 75011540 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | diethyl 5-hydroxy-1,6-dimethyl-5-phenylpiperidine-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1CN(C)C(C)C(O)(c2ccccc2)C1C(=O)OCC |
| InChI | InChI=1S/C19H27NO5/c1-5-24-17(21)15-12-20(4)13(3)19(23,14-10-8-7-9-11-14)16(15)18(22)25-6-2/h7-11,13,15-16,23H,5-6,12H2,1-4H3 |
| InChIKey | NBJVEMYEMULLJP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |