C33H30O6 — CID 11800166
6-O-ethyl 2-O,5-O-dimethyl (1S,2S,5R,6R,7S,8R)-3,4,8-triphenyltricyclo[3.2.1.02,7]oct-3-ene-2,5,6-tricarboxylate (PubChem CID 11800166) has the molecular formula C33H30O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is 6-O-ethyl 2-O,5-O-dimethyl (1S,2S,5R,6R,7S,8R)-3,4,8-triphenyltricyclo[3.2.1.02,7]oct-3-ene-2,5,6-tricarboxylate.
| Compound Name | 6-O-ethyl 2-O,5-O-dimethyl (1S,2S,5R,6R,7S,8R)-3,4,8-triphenyltricyclo[3.2.1.02,7]oct-3-ene-2,5,6-tricarboxylate |
|---|---|
| PubChem CID | 11800166 |
| Molecular Formula | C33H30O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 6-O-ethyl 2-O,5-O-dimethyl (1S,2S,5R,6R,7S,8R)-3,4,8-triphenyltricyclo[3.2.1.02,7]oct-3-ene-2,5,6-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2[C@H]3[C@H](c4ccccc4)[C@]1(C(=O)OC)C(c1ccccc1)=C(c1ccccc1)[C@@]23C(=O)OC |
| InChI | InChI=1S/C33H30O6/c1-4-39-29(34)28-27-26-25(22-18-12-7-13-19-22)32(28,30(35)37-2)23(20-14-8-5-9-15-20)24(21-16-10-6-11-17-21)33(26,27)31(36)38-3/h5-19,25-28H,4H2,1-3H3/t25-,26+,27-,28-,32+,33-/m0/s1 |
| InChIKey | LLVDLVWWPYMRFR-OWZPKEHHSA-N |
| XLogP | 5.15 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|