C19H12Cl2O2 — CID 159187937
3,6-dichloro-9-phenylxanthen-9-ol (PubChem CID 159187937) has the molecular formula C19H12Cl2O2 and a molecular weight of 343.21 g/mol. Its IUPAC name is 3,6-dichloro-9-phenylxanthen-9-ol.
| Compound Name | 3,6-dichloro-9-phenylxanthen-9-ol |
|---|---|
| PubChem CID | 159187937 |
| Molecular Formula | C19H12Cl2O2 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 3,6-dichloro-9-phenylxanthen-9-ol |
| SMILES | OC1(c2ccccc2)c2ccc(Cl)cc2Oc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H12Cl2O2/c20-13-6-8-15-17(10-13)23-18-11-14(21)7-9-16(18)19(15,22)12-4-2-1-3-5-12/h1-11,22H |
| InChIKey | KNSNYXCXRICOKD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |