C15H10ClN3O — CID 24973842
6-chloro-4-phenyl-[1,2,4]triazolo[4,3-a]indol-4-ol (PubChem CID 24973842) has the molecular formula C15H10ClN3O and a molecular weight of 283.72 g/mol. Its IUPAC name is 6-chloro-4-phenyl-[1,2,4]triazolo[4,3-a]indol-4-ol.
| Compound Name | 6-chloro-4-phenyl-[1,2,4]triazolo[4,3-a]indol-4-ol |
|---|---|
| PubChem CID | 24973842 |
| Molecular Formula | C15H10ClN3O |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 6-chloro-4-phenyl-[1,2,4]triazolo[4,3-a]indol-4-ol |
| SMILES | OC1(c2ccccc2)c2cc(Cl)ccc2-n2cnnc21 |
| InChI | InChI=1S/C15H10ClN3O/c16-11-6-7-13-12(8-11)15(20,10-4-2-1-3-5-10)14-18-17-9-19(13)14/h1-9,20H |
| InChIKey | GMXPEZMIJRBPLK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |