C23H13ClN2O2 — CID 162416316
8-chloro-6-hydroxy-6-(2-phenylethynyl)indolo[2,1-b]quinazolin-12-one (PubChem CID 162416316) has the molecular formula C23H13ClN2O2 and a molecular weight of 384.82 g/mol. Its IUPAC name is 8-chloro-6-hydroxy-6-(2-phenylethynyl)indolo[2,1-b]quinazolin-12-one.
| Compound Name | 8-chloro-6-hydroxy-6-(2-phenylethynyl)indolo[2,1-b]quinazolin-12-one |
|---|---|
| PubChem CID | 162416316 |
| Molecular Formula | C23H13ClN2O2 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 8-chloro-6-hydroxy-6-(2-phenylethynyl)indolo[2,1-b]quinazolin-12-one |
| SMILES | O=c1c2ccccc2nc2n1-c1ccc(Cl)cc1C2(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C23H13ClN2O2/c24-16-10-11-20-18(14-16)23(28,13-12-15-6-2-1-3-7-15)22-25-19-9-5-4-8-17(19)21(27)26(20)22/h1-11,14,28H |
| InChIKey | YVBRRJJWDKAMJR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|