C29H20Cl2N4O3 — CID 73403038
2-(2,4-dichlorophenyl)spiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,6'-indolo[2,1-b]quinazoline]-1,3,12'-trione (PubChem CID 73403038) has the molecular formula C29H20Cl2N4O3 and a molecular weight of 543.41 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)spiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,6'-indolo[2,1-b]quinazoline]-1,3,12'-trione.
| Compound Name | 2-(2,4-dichlorophenyl)spiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,6'-indolo[2,1-b]quinazoline]-1,3,12'-trione |
|---|---|
| PubChem CID | 73403038 |
| Molecular Formula | C29H20Cl2N4O3 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | 2-(2,4-dichlorophenyl)spiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,6'-indolo[2,1-b]quinazoline]-1,3,12'-trione |
| SMILES | O=C1C2C3CCCN3C3(c4ccccc4-n4c3nc3ccccc3c4=O)C2C(=O)N1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H20Cl2N4O3/c30-15-11-12-21(18(31)14-15)34-26(37)23-22-10-5-13-33(22)29(24(23)27(34)38)17-7-2-4-9-20(17)35-25(36)16-6-1-3-8-19(16)32-28(29)35/h1-4,6-9,11-12,14,22-24H,5,10,13H2 |
| InChIKey | LACKUSYFZIZRCA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|