C29H20ClN5O5 — CID 98894114
(3aR,4S,8aS,8bS)-2-(4-chloro-3-nitrophenyl)spiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,6'-indolo[2,1-b]quinazoline]-1,3,12'-trione (PubChem CID 98894114) has the molecular formula C29H20ClN5O5 and a molecular weight of 553.96 g/mol. Its IUPAC name is (3aR,4S,8aS,8bS)-2-(4-chloro-3-nitrophenyl)spiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,6'-indolo[2,1-b]quinazoline]-1,3,12'-trione.
| Compound Name | (3aR,4S,8aS,8bS)-2-(4-chloro-3-nitrophenyl)spiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,6'-indolo[2,1-b]quinazoline]-1,3,12'-trione |
|---|---|
| PubChem CID | 98894114 |
| Molecular Formula | C29H20ClN5O5 |
| Molecular Weight | 553.96 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | (3aR,4S,8aS,8bS)-2-(4-chloro-3-nitrophenyl)spiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,6'-indolo[2,1-b]quinazoline]-1,3,12'-trione |
| SMILES | O=C1[C@H]2[C@@H](C(=O)N1c1ccc(Cl)c([N+](=O)[O-])c1)[C@@]1(c3ccccc3-n3c1nc1ccccc1c3=O)N1CCC[C@@H]21 |
| InChI | InChI=1S/C29H20ClN5O5/c30-18-12-11-15(14-22(18)35(39)40)33-26(37)23-21-10-5-13-32(21)29(24(23)27(33)38)17-7-2-4-9-20(17)34-25(36)16-6-1-3-8-19(16)31-28(29)34/h1-4,6-9,11-12,14,21,23-24H,5,10,13H2/t21-,23+,24-,29+/m0/s1 |
| InChIKey | YBOGDGXWQYJNPS-PTCCMZDBSA-N |
| XLogP | 3.79 |
| TPSA | 118.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.96 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|