C29H11F3O7 — CID 90710228
12-phenyl-12-(2,3,4-trifluorophenyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone (PubChem CID 90710228) has the molecular formula C29H11F3O7 and a molecular weight of 528.39 g/mol. Its IUPAC name is 12-phenyl-12-(2,3,4-trifluorophenyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone.
| Compound Name | 12-phenyl-12-(2,3,4-trifluorophenyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone |
|---|---|
| PubChem CID | 90710228 |
| Molecular Formula | C29H11F3O7 |
| Molecular Weight | 528.39 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | 12-phenyl-12-(2,3,4-trifluorophenyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone |
| SMILES | O=C1OC(=O)c2cc3c(cc21)Oc1cc2c(cc1C3(c1ccccc1)c1ccc(F)c(F)c1F)C(=O)OC2=O |
| InChI | InChI=1S/C29H11F3O7/c30-20-7-6-17(23(31)24(20)32)29(12-4-2-1-3-5-12)18-8-13-15(27(35)38-25(13)33)10-21(18)37-22-11-16-14(9-19(22)29)26(34)39-28(16)36/h1-11H |
| InChIKey | HMGRUZARDNCKDB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|