C14H14F2 — CID 166807134
1,1-difluoro-2-methylidene-3-propan-2-ylnaphthalene (PubChem CID 166807134) has the molecular formula C14H14F2 and a molecular weight of 220.26 g/mol. Its IUPAC name is 1,1-difluoro-2-methylidene-3-propan-2-ylnaphthalene.
| Compound Name | 1,1-difluoro-2-methylidene-3-propan-2-ylnaphthalene |
|---|---|
| PubChem CID | 166807134 |
| Molecular Formula | C14H14F2 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1,1-difluoro-2-methylidene-3-propan-2-ylnaphthalene |
| SMILES | C=C1C(C(C)C)=Cc2ccccc2C1(F)F |
| InChI | InChI=1S/C14H14F2/c1-9(2)12-8-11-6-4-5-7-13(11)14(15,16)10(12)3/h4-9H,3H2,1-2H3 |
| InChIKey | SNHJSXGSULATBJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |