C16H13N — CID 151328364
4b-methyl-5H-indeno[1,2-b]indole (PubChem CID 151328364) has the molecular formula C16H13N and a molecular weight of 219.29 g/mol. Its IUPAC name is 4b-methyl-5H-indeno[1,2-b]indole.
| Compound Name | 4b-methyl-5H-indeno[1,2-b]indole |
|---|---|
| PubChem CID | 151328364 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4b-methyl-5H-indeno[1,2-b]indole |
| SMILES | CC12Nc3ccccc3C1=Cc1ccccc12 |
| InChI | InChI=1S/C16H13N/c1-16-13-8-4-2-6-11(13)10-14(16)12-7-3-5-9-15(12)17-16/h2-10,17H,1H3 |
| InChIKey | OHXPBZNQLRLHGN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|