C9H12N4 — CID 129165867
2-methyl-1H-quinazoline-2,4-diamine (PubChem CID 129165867) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-methyl-1H-quinazoline-2,4-diamine.
| Compound Name | 2-methyl-1H-quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 129165867 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-methyl-1H-quinazoline-2,4-diamine |
| SMILES | CC1(N)N=C(N)c2ccccc2N1 |
| InChI | InChI=1S/C9H12N4/c1-9(11)12-7-5-3-2-4-6(7)8(10)13-9/h2-5,12H,11H2,1H3,(H2,10,13) |
| InChIKey | USSJCXUEISEVNE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |