About phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate
phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate (PubChem CID 21192752) has the molecular formula C19H20N4O2
and a molecular weight of 336.40 g/mol. Its IUPAC name is phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate.
Molecular Properties
| Compound Name | phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate |
| PubChem CID | 21192752 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate |
| SMILES | NC1=NC2(CCN(C(=O)Oc3ccccc3)CC2)Nc2ccccc21 |
| InChI | InChI=1S/C19H20N4O2/c20-17-15-8-4-5-9-16(15)21-19(22-17)10-12-23(13-11-19)18(24)25-14-6-2-1-3-7-14/h1-9,21H,10-13H2,(H2,20,22) |
| InChIKey | VQTADZGEXWRKIE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
The IUPAC name of phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate (CID 21192752) is phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate.
What is the SMILES notation for phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
The canonical SMILES for phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate is NC1=NC2(CCN(C(=O)Oc3ccccc3)CC2)Nc2ccccc21.
What is the InChIKey of phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
The InChIKey is VQTADZGEXWRKIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2/c20-17-15-8-4-5-9-16(15)21-19(22-17)10-12-23(13-11-19)18(24)25-14-6-2-1-3-7-14/h1-9,21H,10-13H2,(H2,20,22).
What are the key properties of phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate has a molecular weight of 336.40 g/mol, XLogP of 2.81, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 4-aminospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate is sourced from PubChem (CID 21192752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).