C10H14ClN3 — CID 67569975
2,2-dimethyl-1H-quinazolin-4-amine;hydrochloride (PubChem CID 67569975) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 2,2-dimethyl-1H-quinazolin-4-amine;hydrochloride.
| Compound Name | 2,2-dimethyl-1H-quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 67569975 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2,2-dimethyl-1H-quinazolin-4-amine;hydrochloride |
| SMILES | CC1(C)N=C(N)c2ccccc2N1.Cl |
| InChI | InChI=1S/C10H13N3.ClH/c1-10(2)12-8-6-4-3-5-7(8)9(11)13-10;/h3-6,12H,1-2H3,(H2,11,13);1H |
| InChIKey | QUJSMOIAFOKMIB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |