C10H12N2O — CID 595161
2,2-dimethyl-1,3-dihydroquinazolin-4-one (PubChem CID 595161) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dihydroquinazolin-4-one.
| Compound Name | 2,2-dimethyl-1,3-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 595161 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2,2-dimethyl-1,3-dihydroquinazolin-4-one |
| SMILES | CC1(C)NC(=O)c2ccccc2N1 |
| InChI | InChI=1S/C10H12N2O/c1-10(2)11-8-6-4-3-5-7(8)9(13)12-10/h3-6,11H,1-2H3,(H,12,13) |
| InChIKey | BXJMRXBQNLKDCI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |