C17H17N3O3 — CID 139145821
5,11-dihydrobenzo[c][1,5]benzodiazocine-6,12-dione;N,N-dimethylformamide (PubChem CID 139145821) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 5,11-dihydrobenzo[c][1,5]benzodiazocine-6,12-dione;N,N-dimethylformamide.
| Compound Name | 5,11-dihydrobenzo[c][1,5]benzodiazocine-6,12-dione;N,N-dimethylformamide |
|---|---|
| PubChem CID | 139145821 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 5,11-dihydrobenzo[c][1,5]benzodiazocine-6,12-dione;N,N-dimethylformamide |
| SMILES | CN(C)C=O.O=C1Nc2ccccc2C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C14H10N2O2.C3H7NO/c17-13-9-5-1-3-7-11(9)15-14(18)10-6-2-4-8-12(10)16-13;1-4(2)3-5/h1-8H,(H,15,18)(H,16,17);3H,1-2H3 |
| InChIKey | RPMHKONIRAGWMH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|